C16H28O2 — CID 23552436
5,6-ditert-butyl-3-propyl-2,3-dihydropyran-4-one (PubChem CID 23552436) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 5,6-ditert-butyl-3-propyl-2,3-dihydropyran-4-one.
| Compound Name | 5,6-ditert-butyl-3-propyl-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 23552436 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 5,6-ditert-butyl-3-propyl-2,3-dihydropyran-4-one |
| SMILES | CCCC1COC(C(C)(C)C)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C16H28O2/c1-8-9-11-10-18-14(16(5,6)7)12(13(11)17)15(2,3)4/h11H,8-10H2,1-7H3 |
| InChIKey | DKEPKYUHFWXFRT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |