C23H27N3O4 — CID 23552805
tert-butyl N-[(2S)-1-(5-amino-7-methyl-6-oxo-7H-benzo[d][1]benzazepin-1-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 23552805) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(5-amino-7-methyl-6-oxo-7H-benzo[d][1]benzazepin-1-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(5-amino-7-methyl-6-oxo-7H-benzo[d][1]benzazepin-1-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 23552805 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | tert-butyl N-[(2S)-1-(5-amino-7-methyl-6-oxo-7H-benzo[d][1]benzazepin-1-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | CC1C(=O)N(N)c2cccc(C(=O)[C@H](C)NC(=O)OC(C)(C)C)c2-c2ccccc21 |
| InChI | InChI=1S/C23H27N3O4/c1-13-15-9-6-7-10-16(15)19-17(11-8-12-18(19)26(24)21(13)28)20(27)14(2)25-22(29)30-23(3,4)5/h6-14H,24H2,1-5H3,(H,25,29)/t13?,14-/m0/s1 |
| InChIKey | DRBLBVMOZBOKBI-KZUDCZAMSA-N |
| XLogP | 3.77 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|