C15H12N2O8S2 — CID 23553032
[3-(4-oxo-7-sulfamoyloxychromen-2-yl)phenyl] sulfamate (PubChem CID 23553032) has the molecular formula C15H12N2O8S2 and a molecular weight of 412.40 g/mol. Its IUPAC name is [3-(4-oxo-7-sulfamoyloxychromen-2-yl)phenyl] sulfamate.
| Compound Name | [3-(4-oxo-7-sulfamoyloxychromen-2-yl)phenyl] sulfamate |
|---|---|
| PubChem CID | 23553032 |
| Molecular Formula | C15H12N2O8S2 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | [3-(4-oxo-7-sulfamoyloxychromen-2-yl)phenyl] sulfamate |
| SMILES | NS(=O)(=O)Oc1cccc(-c2cc(=O)c3ccc(OS(N)(=O)=O)cc3o2)c1 |
| InChI | InChI=1S/C15H12N2O8S2/c16-26(19,20)24-10-3-1-2-9(6-10)14-8-13(18)12-5-4-11(7-15(12)23-14)25-27(17,21)22/h1-8H,(H2,16,19,20)(H2,17,21,22) |
| InChIKey | FBNUZTVEBFFXAM-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 168.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |