C24H47NO3Sn — CID 23553891
[4-[(E)-1-methoxy-3-tributylstannylprop-2-enyl]-1-methylpiperidin-3-yl] acetate (PubChem CID 23553891) has the molecular formula C24H47NO3Sn and a molecular weight of 516.36 g/mol. Its IUPAC name is [4-[(E)-1-methoxy-3-tributylstannylprop-2-enyl]-1-methylpiperidin-3-yl] acetate.
| Compound Name | [4-[(E)-1-methoxy-3-tributylstannylprop-2-enyl]-1-methylpiperidin-3-yl] acetate |
|---|---|
| PubChem CID | 23553891 |
| Molecular Formula | C24H47NO3Sn |
| Molecular Weight | 516.36 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | [4-[(E)-1-methoxy-3-tributylstannylprop-2-enyl]-1-methylpiperidin-3-yl] acetate |
| SMILES | CCCC[Sn](/C=C/C(OC)C1CCN(C)CC1OC(C)=O)(CCCC)CCCC |
| InChI | InChI=1S/C12H20NO3.3C4H9.Sn/c1-5-11(15-4)10-6-7-13(3)8-12(10)16-9(2)14;3*1-3-4-2;/h1,5,10-12H,6-8H2,2-4H3;3*1,3-4H2,2H3; |
| InChIKey | YAPKFIYFGUTALB-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.36 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |