C13H22INO4 — CID 59033121
[(E)-3-iodo-1-[3-(methoxymethoxy)-1-(114C)methylpiperidin-4-yl]prop-2-enyl] acetate (PubChem CID 59033121) has the molecular formula C13H22INO4 and a molecular weight of 385.22 g/mol. Its IUPAC name is [(E)-3-iodo-1-[3-(methoxymethoxy)-1-(114C)methylpiperidin-4-yl]prop-2-enyl] acetate.
| Compound Name | [(E)-3-iodo-1-[3-(methoxymethoxy)-1-(114C)methylpiperidin-4-yl]prop-2-enyl] acetate |
|---|---|
| PubChem CID | 59033121 |
| Molecular Formula | C13H22INO4 |
| Molecular Weight | 385.22 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | [(E)-3-iodo-1-[3-(methoxymethoxy)-1-(114C)methylpiperidin-4-yl]prop-2-enyl] acetate |
| SMILES | COCOC1CN([14CH3])CCC1C(/C=C/I)OC(C)=O |
| InChI | InChI=1S/C13H22INO4/c1-10(16)19-12(4-6-14)11-5-7-15(2)8-13(11)18-9-17-3/h4,6,11-13H,5,7-9H2,1-3H3/b6-4+/i2+2 |
| InChIKey | GVWBABOWOAZDSD-AXVLECGHSA-N |
| XLogP | 1.81 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|