About 2-iodo-5-nitro-N'-(pyridin-3-yloxymethyl)benzohydrazide
2-iodo-5-nitro-N'-(pyridin-3-yloxymethyl)benzohydrazide (PubChem CID 23557253) has the molecular formula C13H11IN4O4
and a molecular weight of 414.16 g/mol. Its IUPAC name is 2-iodo-5-nitro-N'-(pyridin-3-yloxymethyl)benzohydrazide.
Molecular Properties
| Compound Name | 2-iodo-5-nitro-N'-(pyridin-3-yloxymethyl)benzohydrazide |
| PubChem CID | 23557253 |
| Molecular Formula | C13H11IN4O4 |
| Molecular Weight | 414.16 g/mol |
| Exact Mass | 413.98 |
| IUPAC Name | 2-iodo-5-nitro-N'-(pyridin-3-yloxymethyl)benzohydrazide |
| SMILES | O=C(NNCOc1cccnc1)c1cc([N+](=O)[O-])ccc1I |
| InChI | InChI=1S/C13H11IN4O4/c14-12-4-3-9(18(20)21)6-11(12)13(19)17-16-8-22-10-2-1-5-15-7-10/h1-7,16H,8H2,(H,17,19) |
| InChIKey | QAPFVRMBZPZXPC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.16 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-5-nitro-N'-(pyridin-3-yloxymethyl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-5-nitro-N'-(pyridin-3-yloxymethyl)benzohydrazide?
The IUPAC name of 2-iodo-5-nitro-N'-(pyridin-3-yloxymethyl)benzohydrazide (CID 23557253) is 2-iodo-5-nitro-N'-(pyridin-3-yloxymethyl)benzohydrazide.
What is the SMILES notation for 2-iodo-5-nitro-N'-(pyridin-3-yloxymethyl)benzohydrazide?
The canonical SMILES for 2-iodo-5-nitro-N'-(pyridin-3-yloxymethyl)benzohydrazide is O=C(NNCOc1cccnc1)c1cc([N+](=O)[O-])ccc1I.
What is the InChIKey of 2-iodo-5-nitro-N'-(pyridin-3-yloxymethyl)benzohydrazide?
The InChIKey is QAPFVRMBZPZXPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11IN4O4/c14-12-4-3-9(18(20)21)6-11(12)13(19)17-16-8-22-10-2-1-5-15-7-10/h1-7,16H,8H2,(H,17,19).
What are the key properties of 2-iodo-5-nitro-N'-(pyridin-3-yloxymethyl)benzohydrazide?
2-iodo-5-nitro-N'-(pyridin-3-yloxymethyl)benzohydrazide has a molecular weight of 414.16 g/mol, XLogP of 1.87, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-5-nitro-N'-(pyridin-3-yloxymethyl)benzohydrazide is sourced from PubChem (CID 23557253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).