C13H12IN3O3S — CID 104579241
2-iodo-5-nitro-N-[2-(1,3-thiazol-2-yl)propyl]benzamide (PubChem CID 104579241) has the molecular formula C13H12IN3O3S and a molecular weight of 417.23 g/mol. Its IUPAC name is 2-iodo-5-nitro-N-[2-(1,3-thiazol-2-yl)propyl]benzamide.
| Compound Name | 2-iodo-5-nitro-N-[2-(1,3-thiazol-2-yl)propyl]benzamide |
|---|---|
| PubChem CID | 104579241 |
| Molecular Formula | C13H12IN3O3S |
| Molecular Weight | 417.23 g/mol |
| Exact Mass | 416.96 |
| IUPAC Name | 2-iodo-5-nitro-N-[2-(1,3-thiazol-2-yl)propyl]benzamide |
| SMILES | CC(CNC(=O)c1cc([N+](=O)[O-])ccc1I)c1nccs1 |
| InChI | InChI=1S/C13H12IN3O3S/c1-8(13-15-4-5-21-13)7-16-12(18)10-6-9(17(19)20)2-3-11(10)14/h2-6,8H,7H2,1H3,(H,16,18) |
| InChIKey | POUMMXRYPZIJNS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|