C14H16N4O3S — CID 86804078
1-(2-methyl-4-nitrophenyl)-3-[2-(1,3-thiazol-2-yl)propyl]urea (PubChem CID 86804078) has the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is 1-(2-methyl-4-nitrophenyl)-3-[2-(1,3-thiazol-2-yl)propyl]urea.
| Compound Name | 1-(2-methyl-4-nitrophenyl)-3-[2-(1,3-thiazol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 86804078 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 1-(2-methyl-4-nitrophenyl)-3-[2-(1,3-thiazol-2-yl)propyl]urea |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)NCC(C)c1nccs1 |
| InChI | InChI=1S/C14H16N4O3S/c1-9-7-11(18(20)21)3-4-12(9)17-14(19)16-8-10(2)13-15-5-6-22-13/h3-7,10H,8H2,1-2H3,(H2,16,17,19) |
| InChIKey | RDTOGVKVJHKHDQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|