C13H12IN3O3S — CID 103709179
N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-iodo-5-nitrobenzamide (PubChem CID 103709179) has the molecular formula C13H12IN3O3S and a molecular weight of 417.23 g/mol. Its IUPAC name is N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-iodo-5-nitrobenzamide.
| Compound Name | N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-iodo-5-nitrobenzamide |
|---|---|
| PubChem CID | 103709179 |
| Molecular Formula | C13H12IN3O3S |
| Molecular Weight | 417.23 g/mol |
| Exact Mass | 416.96 |
| IUPAC Name | N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-iodo-5-nitrobenzamide |
| SMILES | CCc1cnc(CNC(=O)c2cc([N+](=O)[O-])ccc2I)s1 |
| InChI | InChI=1S/C13H12IN3O3S/c1-2-9-6-15-12(21-9)7-16-13(18)10-5-8(17(19)20)3-4-11(10)14/h3-6H,2,7H2,1H3,(H,16,18) |
| InChIKey | SHMQCZWIQWPFLR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.23 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|