C14H18IN3O3 — CID 43317557
N-[(1-ethylpyrrolidin-2-yl)methyl]-2-iodo-5-nitrobenzamide (PubChem CID 43317557) has the molecular formula C14H18IN3O3 and a molecular weight of 403.22 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-2-yl)methyl]-2-iodo-5-nitrobenzamide.
| Compound Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-2-iodo-5-nitrobenzamide |
|---|---|
| PubChem CID | 43317557 |
| Molecular Formula | C14H18IN3O3 |
| Molecular Weight | 403.22 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-2-iodo-5-nitrobenzamide |
| SMILES | CCN1CCCC1CNC(=O)c1cc([N+](=O)[O-])ccc1I |
| InChI | InChI=1S/C14H18IN3O3/c1-2-17-7-3-4-11(17)9-16-14(19)12-8-10(18(20)21)5-6-13(12)15/h5-6,8,11H,2-4,7,9H2,1H3,(H,16,19) |
| InChIKey | CCLSFTTWCHLYKW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|