C15H21N3O3 — CID 84926786
N-[(1-ethylpyrrolidin-2-yl)methyl]-3-methyl-4-nitrobenzamide (PubChem CID 84926786) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-2-yl)methyl]-3-methyl-4-nitrobenzamide.
| Compound Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 84926786 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-3-methyl-4-nitrobenzamide |
| SMILES | CCN1CCCC1CNC(=O)c1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C15H21N3O3/c1-3-17-8-4-5-13(17)10-16-15(19)12-6-7-14(18(20)21)11(2)9-12/h6-7,9,13H,3-5,8,10H2,1-2H3,(H,16,19) |
| InChIKey | AZCMKMCNMVSLCY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|