C24H26O4Zr — CID 23558306
4-cyclohexylbenzene-1,2-diol;4-phenylbenzene-1,2-diol;zirconium (PubChem CID 23558306) has the molecular formula C24H26O4Zr and a molecular weight of 469.69 g/mol. Its IUPAC name is 4-cyclohexylbenzene-1,2-diol;4-phenylbenzene-1,2-diol;zirconium.
| Compound Name | 4-cyclohexylbenzene-1,2-diol;4-phenylbenzene-1,2-diol;zirconium |
|---|---|
| PubChem CID | 23558306 |
| Molecular Formula | C24H26O4Zr |
| Molecular Weight | 469.69 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 4-cyclohexylbenzene-1,2-diol;4-phenylbenzene-1,2-diol;zirconium |
| SMILES | Oc1ccc(-c2ccccc2)cc1O.Oc1ccc(C2CCCCC2)cc1O.[Zr] |
| InChI | InChI=1S/C12H16O2.C12H10O2.Zr/c2*13-11-7-6-10(8-12(11)14)9-4-2-1-3-5-9;/h6-9,13-14H,1-5H2;1-8,13-14H; |
| InChIKey | POXVNMXDLGZPQD-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.69 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|