C13H18O4 — CID 23561036
1,3-dioxolan-4-ylmethyl 2-(2-bicyclo[2.2.1]hept-5-enyl)acetate (PubChem CID 23561036) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 1,3-dioxolan-4-ylmethyl 2-(2-bicyclo[2.2.1]hept-5-enyl)acetate.
| Compound Name | 1,3-dioxolan-4-ylmethyl 2-(2-bicyclo[2.2.1]hept-5-enyl)acetate |
|---|---|
| PubChem CID | 23561036 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 1,3-dioxolan-4-ylmethyl 2-(2-bicyclo[2.2.1]hept-5-enyl)acetate |
| SMILES | O=C(CC1CC2C=CC1C2)OCC1COCO1 |
| InChI | InChI=1S/C13H18O4/c14-13(16-7-12-6-15-8-17-12)5-11-4-9-1-2-10(11)3-9/h1-2,9-12H,3-8H2 |
| InChIKey | WDXMBPLGZCZOIH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|