C17H22O5 — CID 134975386
5'-methylspiro[1,3-dioxolane-2,10'-4-oxatricyclo[10.2.1.02,11]pentadec-13-ene]-3',8'-dione (PubChem CID 134975386) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is 5'-methylspiro[1,3-dioxolane-2,10'-4-oxatricyclo[10.2.1.02,11]pentadec-13-ene]-3',8'-dione.
| Compound Name | 5'-methylspiro[1,3-dioxolane-2,10'-4-oxatricyclo[10.2.1.02,11]pentadec-13-ene]-3',8'-dione |
|---|---|
| PubChem CID | 134975386 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 5'-methylspiro[1,3-dioxolane-2,10'-4-oxatricyclo[10.2.1.02,11]pentadec-13-ene]-3',8'-dione |
| SMILES | CC1CCC(=O)CC2(OCCO2)C2C3C=CC(C3)C2C(=O)O1 |
| InChI | InChI=1S/C17H22O5/c1-10-2-5-13(18)9-17(20-6-7-21-17)15-12-4-3-11(8-12)14(15)16(19)22-10/h3-4,10-12,14-15H,2,5-9H2,1H3 |
| InChIKey | OPWSQLFYCFXKNB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|