C14H20O4 — CID 23561040
1,3-dioxolan-4-ylmethyl 3-(2-bicyclo[2.2.1]hept-5-enyl)propanoate (PubChem CID 23561040) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 1,3-dioxolan-4-ylmethyl 3-(2-bicyclo[2.2.1]hept-5-enyl)propanoate.
| Compound Name | 1,3-dioxolan-4-ylmethyl 3-(2-bicyclo[2.2.1]hept-5-enyl)propanoate |
|---|---|
| PubChem CID | 23561040 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 1,3-dioxolan-4-ylmethyl 3-(2-bicyclo[2.2.1]hept-5-enyl)propanoate |
| SMILES | O=C(CCC1CC2C=CC1C2)OCC1COCO1 |
| InChI | InChI=1S/C14H20O4/c15-14(17-8-13-7-16-9-18-13)4-3-12-6-10-1-2-11(12)5-10/h1-2,10-13H,3-9H2 |
| InChIKey | KPGQVTDYSXMVBR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|