C16H22O5 — CID 102072075
methyl (3S,3aS,5aR,7R,8aR,8bS)-3-methoxy-3,4-dimethyl-8-oxo-3a,5a,6,7,8a,8b-hexahydro-1H-cyclopenta[e][2]benzofuran-7-carboxylate (PubChem CID 102072075) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is methyl (3S,3aS,5aR,7R,8aR,8bS)-3-methoxy-3,4-dimethyl-8-oxo-3a,5a,6,7,8a,8b-hexahydro-1H-cyclopenta[e][2]benzofuran-7-carboxylate.
| Compound Name | methyl (3S,3aS,5aR,7R,8aR,8bS)-3-methoxy-3,4-dimethyl-8-oxo-3a,5a,6,7,8a,8b-hexahydro-1H-cyclopenta[e][2]benzofuran-7-carboxylate |
|---|---|
| PubChem CID | 102072075 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | methyl (3S,3aS,5aR,7R,8aR,8bS)-3-methoxy-3,4-dimethyl-8-oxo-3a,5a,6,7,8a,8b-hexahydro-1H-cyclopenta[e][2]benzofuran-7-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2C=C(C)[C@@H]3[C@@H](CO[C@]3(C)OC)[C@@H]2C1=O |
| InChI | InChI=1S/C16H22O5/c1-8-5-9-6-10(15(18)19-3)14(17)12(9)11-7-21-16(2,20-4)13(8)11/h5,9-13H,6-7H2,1-4H3/t9-,10+,11-,12+,13+,16-/m0/s1 |
| InChIKey | UPGRNGQTABGMQQ-WRBUKDQESA-N |
| XLogP | 1.57 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|