C18H28O4 — CID 23561052
1,3-dioxolan-4-ylmethyl 7-(2-bicyclo[2.2.1]hept-5-enyl)heptanoate (PubChem CID 23561052) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is 1,3-dioxolan-4-ylmethyl 7-(2-bicyclo[2.2.1]hept-5-enyl)heptanoate.
| Compound Name | 1,3-dioxolan-4-ylmethyl 7-(2-bicyclo[2.2.1]hept-5-enyl)heptanoate |
|---|---|
| PubChem CID | 23561052 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 1,3-dioxolan-4-ylmethyl 7-(2-bicyclo[2.2.1]hept-5-enyl)heptanoate |
| SMILES | O=C(CCCCCCC1CC2C=CC1C2)OCC1COCO1 |
| InChI | InChI=1S/C18H28O4/c19-18(21-12-17-11-20-13-22-17)6-4-2-1-3-5-15-9-14-7-8-16(15)10-14/h7-8,14-17H,1-6,9-13H2 |
| InChIKey | RVLLFJGYZOHVGC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|