C16H24NO3S- — CID 23561590
[[4-(2,2-dimethylbutanoylamino)phenyl]-hydroxy-propan-2-ylidene-λ6-sulfanylidene]methanolate (PubChem CID 23561590) has the molecular formula C16H24NO3S- and a molecular weight of 310.44 g/mol. Its IUPAC name is [[4-(2,2-dimethylbutanoylamino)phenyl]-hydroxy-propan-2-ylidene-λ6-sulfanylidene]methanolate.
| Compound Name | [[4-(2,2-dimethylbutanoylamino)phenyl]-hydroxy-propan-2-ylidene-λ6-sulfanylidene]methanolate |
|---|---|
| PubChem CID | 23561590 |
| Molecular Formula | C16H24NO3S- |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | [[4-(2,2-dimethylbutanoylamino)phenyl]-hydroxy-propan-2-ylidene-λ6-sulfanylidene]methanolate |
| SMILES | CCC(C)(C)C(=O)Nc1ccc(S(O)(=C[O-])=C(C)C)cc1 |
| InChI | InChI=1S/C16H25NO3S/c1-6-16(4,5)15(19)17-13-7-9-14(10-8-13)21(20,11-18)12(2)3/h7-11,18,20H,6H2,1-5H3,(H,17,19)/p-1 |
| InChIKey | HRMIVKZXDQAWDI-UHFFFAOYSA-M |
| XLogP | 3.03 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|