C21H15ClF2N2O3 — CID 23562051
N-[2-chloro-5-hydroxy-4-[(4-methylbenzoyl)amino]phenyl]-2,4-difluorobenzamide (PubChem CID 23562051) has the molecular formula C21H15ClF2N2O3 and a molecular weight of 416.81 g/mol. Its IUPAC name is N-[2-chloro-5-hydroxy-4-[(4-methylbenzoyl)amino]phenyl]-2,4-difluorobenzamide.
| Compound Name | N-[2-chloro-5-hydroxy-4-[(4-methylbenzoyl)amino]phenyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 23562051 |
| Molecular Formula | C21H15ClF2N2O3 |
| Molecular Weight | 416.81 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | N-[2-chloro-5-hydroxy-4-[(4-methylbenzoyl)amino]phenyl]-2,4-difluorobenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(Cl)c(NC(=O)c3ccc(F)cc3F)cc2O)cc1 |
| InChI | InChI=1S/C21H15ClF2N2O3/c1-11-2-4-12(5-3-11)20(28)26-18-9-15(22)17(10-19(18)27)25-21(29)14-7-6-13(23)8-16(14)24/h2-10,27H,1H3,(H,25,29)(H,26,28) |
| InChIKey | AXENQDMAZKHNRZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.81 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|