C17H13F5N2O — CID 2356378
N-(2-morpholin-4-ylphenyl)-1-(2,3,4,5,6-pentafluorophenyl)methanimine (PubChem CID 2356378) has the molecular formula C17H13F5N2O and a molecular weight of 356.29 g/mol. Its IUPAC name is N-(2-morpholin-4-ylphenyl)-1-(2,3,4,5,6-pentafluorophenyl)methanimine.
| Compound Name | N-(2-morpholin-4-ylphenyl)-1-(2,3,4,5,6-pentafluorophenyl)methanimine |
|---|---|
| PubChem CID | 2356378 |
| Molecular Formula | C17H13F5N2O |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | N-(2-morpholin-4-ylphenyl)-1-(2,3,4,5,6-pentafluorophenyl)methanimine |
| SMILES | Fc1c(F)c(F)c(/C=N/c2ccccc2N2CCOCC2)c(F)c1F |
| InChI | InChI=1S/C17H13F5N2O/c18-13-10(14(19)16(21)17(22)15(13)20)9-23-11-3-1-2-4-12(11)24-5-7-25-8-6-24/h1-4,9H,5-8H2/b23-9+ |
| InChIKey | MQMAYSLZVVCHPL-NUGSKGIGSA-N |
| XLogP | 3.97 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|