C9H15NS — CID 23567364
2-(2,3-dihydrothiophen-2-yl)pent-4-en-1-amine (PubChem CID 23567364) has the molecular formula C9H15NS and a molecular weight of 169.29 g/mol. Its IUPAC name is 2-(2,3-dihydrothiophen-2-yl)pent-4-en-1-amine.
| Compound Name | 2-(2,3-dihydrothiophen-2-yl)pent-4-en-1-amine |
|---|---|
| PubChem CID | 23567364 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 2-(2,3-dihydrothiophen-2-yl)pent-4-en-1-amine |
| SMILES | C=CCC(CN)C1CC=CS1 |
| InChI | InChI=1S/C9H15NS/c1-2-4-8(7-10)9-5-3-6-11-9/h2-3,6,8-9H,1,4-5,7,10H2 |
| InChIKey | CYEXRBFIHGBQCD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|