C17H24N4O6 — CID 23568297
1-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(4-imidazol-1-ylbutoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 23568297) has the molecular formula C17H24N4O6 and a molecular weight of 380.40 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(4-imidazol-1-ylbutoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(4-imidazol-1-ylbutoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 23568297 |
| Molecular Formula | C17H24N4O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(4-imidazol-1-ylbutoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2OCCCCn2ccnc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H24N4O6/c1-11-8-21(17(25)19-15(11)24)16-14(13(23)12(9-22)27-16)26-7-3-2-5-20-6-4-18-10-20/h4,6,8,10,12-14,16,22-23H,2-3,5,7,9H2,1H3,(H,19,24,25)/t12-,13-,14-,16-/m1/s1 |
| InChIKey | FECPSSBTRSMJEL-IXYNUQLISA-N |
| XLogP | -0.84 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|