C21H34N4O6 — CID 101138639
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-4,5-bis(4-imidazol-1-ylbutoxy)-6-methoxyoxan-3-ol (PubChem CID 101138639) has the molecular formula C21H34N4O6 and a molecular weight of 438.53 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-4,5-bis(4-imidazol-1-ylbutoxy)-6-methoxyoxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-4,5-bis(4-imidazol-1-ylbutoxy)-6-methoxyoxan-3-ol |
|---|---|
| PubChem CID | 101138639 |
| Molecular Formula | C21H34N4O6 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-4,5-bis(4-imidazol-1-ylbutoxy)-6-methoxyoxan-3-ol |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](O)[C@H](OCCCCn2ccnc2)[C@H]1OCCCCn1ccnc1 |
| InChI | InChI=1S/C21H34N4O6/c1-28-21-20(30-13-5-3-9-25-11-7-23-16-25)19(18(27)17(14-26)31-21)29-12-4-2-8-24-10-6-22-15-24/h6-7,10-11,15-21,26-27H,2-5,8-9,12-14H2,1H3/t17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | BWALRIMXIUYQRK-ADAARDCZSA-N |
| XLogP | 0.84 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|