C33H48Cl2N4O6 — CID 11093597
(2R,3R,4S,5R,6S)-4,5-bis[4-(5,6-dimethyl-3H-benzimidazol-1-ium-1-yl)butoxy]-2-(hydroxymethyl)-6-methoxyoxan-3-ol dichloride (PubChem CID 11093597) has the molecular formula C33H48Cl2N4O6 and a molecular weight of 667.68 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-4,5-bis[4-(5,6-dimethyl-3H-benzimidazol-1-ium-1-yl)butoxy]-2-(hydroxymethyl)-6-methoxyoxan-3-ol dichloride.
| Compound Name | (2R,3R,4S,5R,6S)-4,5-bis[4-(5,6-dimethyl-3H-benzimidazol-1-ium-1-yl)butoxy]-2-(hydroxymethyl)-6-methoxyoxan-3-ol dichloride |
|---|---|
| PubChem CID | 11093597 |
| Molecular Formula | C33H48Cl2N4O6 |
| Molecular Weight | 667.68 g/mol |
| Exact Mass | 666.30 |
| IUPAC Name | (2R,3R,4S,5R,6S)-4,5-bis[4-(5,6-dimethyl-3H-benzimidazol-1-ium-1-yl)butoxy]-2-(hydroxymethyl)-6-methoxyoxan-3-ol dichloride |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](O)[C@H](OCCCC[n+]2c[nH]c3cc(C)c(C)cc32)[C@H]1OCCCC[n+]1c[nH]c2cc(C)c(C)cc21.[Cl-].[Cl-] |
| InChI | InChI=1S/C33H46N4O6.2ClH/c1-21-14-25-27(16-23(21)3)36(19-34-25)10-6-8-12-41-31-30(39)29(18-38)43-33(40-5)32(31)42-13-9-7-11-37-20-35-26-15-22(2)24(4)17-28(26)37;;/h14-17,19-20,29-33,38-39H,6-13,18H2,1-5H3;2*1H/t29-,30-,31+,32-,33+;;/m1../s1 |
| InChIKey | OYAKYXZZZGRFMF-VGQRTDGFSA-N |
| XLogP | -2.78 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.68 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|