C25H48O6 — CID 141122499
(2R,3S,4S,5R)-2-(hydroxymethyl)-6-methoxy-5-[(Z)-octadec-11-enoxy]oxane-3,4-diol (PubChem CID 141122499) has the molecular formula C25H48O6 and a molecular weight of 444.65 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(hydroxymethyl)-6-methoxy-5-[(Z)-octadec-11-enoxy]oxane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-methoxy-5-[(Z)-octadec-11-enoxy]oxane-3,4-diol |
|---|---|
| PubChem CID | 141122499 |
| Molecular Formula | C25H48O6 |
| Molecular Weight | 444.65 g/mol |
| Exact Mass | 444.35 |
| IUPAC Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-methoxy-5-[(Z)-octadec-11-enoxy]oxane-3,4-diol |
| SMILES | CCCCCC/C=C\CCCCCCCCCCO[C@H]1C(OC)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H48O6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-30-24-23(28)22(27)21(20-26)31-25(24)29-2/h8-9,21-28H,3-7,10-20H2,1-2H3/b9-8-/t21-,22-,23+,24-,25?/m1/s1 |
| InChIKey | QISSHJCTGUHJMN-KIRPLJCZSA-N |
| XLogP | 4.49 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.65 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|