C21H24N4O6 — CID 44611139
3-(4-imidazol-1-ylbutyl)-6-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzene-1,2-dicarbonitrile (PubChem CID 44611139) has the molecular formula C21H24N4O6 and a molecular weight of 428.45 g/mol. Its IUPAC name is 3-(4-imidazol-1-ylbutyl)-6-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzene-1,2-dicarbonitrile.
| Compound Name | 3-(4-imidazol-1-ylbutyl)-6-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 44611139 |
| Molecular Formula | C21H24N4O6 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 3-(4-imidazol-1-ylbutyl)-6-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(CCCCn2ccnc2)ccc(O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)c1C#N |
| InChI | InChI=1S/C21H24N4O6/c22-9-14-13(3-1-2-7-25-8-6-24-12-25)4-5-16(15(14)10-23)30-21-20(29)19(28)18(27)17(11-26)31-21/h4-6,8,12,17-21,26-29H,1-3,7,11H2/t17-,18+,19+,20-,21-/m1/s1 |
| InChIKey | RHUOKYINDYHNTD-XDWAVFMPSA-N |
| XLogP | -0.17 |
| TPSA | 164.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|