C20H17N3O3 — CID 23569353
1-[[7-(hydroxymethyl)-6-methoxyquinazolin-4-yl]amino]naphthalen-2-ol (PubChem CID 23569353) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is 1-[[7-(hydroxymethyl)-6-methoxyquinazolin-4-yl]amino]naphthalen-2-ol.
| Compound Name | 1-[[7-(hydroxymethyl)-6-methoxyquinazolin-4-yl]amino]naphthalen-2-ol |
|---|---|
| PubChem CID | 23569353 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 1-[[7-(hydroxymethyl)-6-methoxyquinazolin-4-yl]amino]naphthalen-2-ol |
| SMILES | COc1cc2c(Nc3c(O)ccc4ccccc34)ncnc2cc1CO |
| InChI | InChI=1S/C20H17N3O3/c1-26-18-9-15-16(8-13(18)10-24)21-11-22-20(15)23-19-14-5-3-2-4-12(14)6-7-17(19)25/h2-9,11,24-25H,10H2,1H3,(H,21,22,23) |
| InChIKey | VCIJNWSQQIAKBN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|