C29H29F2N7O3 — CID 23570294
7-[3-[[4-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]methyl]phenyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine (PubChem CID 23570294) has the molecular formula C29H29F2N7O3 and a molecular weight of 561.59 g/mol. Its IUPAC name is 7-[3-[[4-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]methyl]phenyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine.
| Compound Name | 7-[3-[[4-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]methyl]phenyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 23570294 |
| Molecular Formula | C29H29F2N7O3 |
| Molecular Weight | 561.59 g/mol |
| Exact Mass | 561.23 |
| IUPAC Name | 7-[3-[[4-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]methyl]phenyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
| SMILES | COCCOc1cc(F)c(N2CCN(Cc3cccc(-c4cc5nc(-c6ccco6)nn5c(N)n4)c3)CC2)c(F)c1 |
| InChI | InChI=1S/C29H29F2N7O3/c1-39-12-13-40-21-15-22(30)27(23(31)16-21)37-9-7-36(8-10-37)18-19-4-2-5-20(14-19)24-17-26-34-28(25-6-3-11-41-25)35-38(26)29(32)33-24/h2-6,11,14-17H,7-10,12-13,18H2,1H3,(H2,32,33) |
| InChIKey | POXHPVUWFKPIPK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|