C18H26N2 — CID 23570444
3,5-ditert-butyl-1-(4-methylphenyl)pyrazole (PubChem CID 23570444) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 3,5-ditert-butyl-1-(4-methylphenyl)pyrazole.
| Compound Name | 3,5-ditert-butyl-1-(4-methylphenyl)pyrazole |
|---|---|
| PubChem CID | 23570444 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 3,5-ditert-butyl-1-(4-methylphenyl)pyrazole |
| SMILES | Cc1ccc(-n2nc(C(C)(C)C)cc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H26N2/c1-13-8-10-14(11-9-13)20-16(18(5,6)7)12-15(19-20)17(2,3)4/h8-12H,1-7H3 |
| InChIKey | JNCPDIQVTWARDH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |