C16H29F3O3 — CID 23571828
tert-butyl 9,9,9-trifluoro-8-hydroxy-4,5,8-trimethylnonanoate (PubChem CID 23571828) has the molecular formula C16H29F3O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is tert-butyl 9,9,9-trifluoro-8-hydroxy-4,5,8-trimethylnonanoate.
| Compound Name | tert-butyl 9,9,9-trifluoro-8-hydroxy-4,5,8-trimethylnonanoate |
|---|---|
| PubChem CID | 23571828 |
| Molecular Formula | C16H29F3O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | tert-butyl 9,9,9-trifluoro-8-hydroxy-4,5,8-trimethylnonanoate |
| SMILES | CC(CCC(=O)OC(C)(C)C)C(C)CCC(C)(O)C(F)(F)F |
| InChI | InChI=1S/C16H29F3O3/c1-11(7-8-13(20)22-14(3,4)5)12(2)9-10-15(6,21)16(17,18)19/h11-12,21H,7-10H2,1-6H3 |
| InChIKey | MKFMRVMWXVQEPU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |