C18H34 — CID 23571929
2,3-dimethyl-6a-pentan-2-yl-1-propan-2-yl-2,3,3a,4,5,6-hexahydro-1H-pentalene (PubChem CID 23571929) has the molecular formula C18H34 and a molecular weight of 250.47 g/mol. Its IUPAC name is 2,3-dimethyl-6a-pentan-2-yl-1-propan-2-yl-2,3,3a,4,5,6-hexahydro-1H-pentalene.
| Compound Name | 2,3-dimethyl-6a-pentan-2-yl-1-propan-2-yl-2,3,3a,4,5,6-hexahydro-1H-pentalene |
|---|---|
| PubChem CID | 23571929 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | 2,3-dimethyl-6a-pentan-2-yl-1-propan-2-yl-2,3,3a,4,5,6-hexahydro-1H-pentalene |
| SMILES | CCCC(C)C12CCCC1C(C)C(C)C2C(C)C |
| InChI | InChI=1S/C18H34/c1-7-9-13(4)18-11-8-10-16(18)14(5)15(6)17(18)12(2)3/h12-17H,7-11H2,1-6H3 |
| InChIKey | MMPXDXKVMDRJQN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |