C5H11BO2 — CID 23572285
2,4-dimethyl-1,3,2-dioxaborinane (PubChem CID 23572285) has the molecular formula C5H11BO2 and a molecular weight of 113.95 g/mol. Its IUPAC name is 2,4-dimethyl-1,3,2-dioxaborinane.
| Compound Name | 2,4-dimethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 23572285 |
| Molecular Formula | C5H11BO2 |
| Molecular Weight | 113.95 g/mol |
| Exact Mass | 114.09 |
| IUPAC Name | 2,4-dimethyl-1,3,2-dioxaborinane |
| SMILES | CB1OCCC(C)O1 |
| InChI | InChI=1S/C5H11BO2/c1-5-3-4-7-6(2)8-5/h5H,3-4H2,1-2H3 |
| InChIKey | RLDNRQYSPXEEMY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.95 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|