About 2,4-dimethyl-1,3,2-dioxaborinane
2,4-dimethyl-1,3,2-dioxaborinane (PubChem CID 23572285) has the molecular formula C5H11BO2
and a molecular weight of 113.95 g/mol. Its IUPAC name is 2,4-dimethyl-1,3,2-dioxaborinane.
Molecular Properties
| Compound Name | 2,4-dimethyl-1,3,2-dioxaborinane |
| PubChem CID | 23572285 |
| Molecular Formula | C5H11BO2 |
| Molecular Weight | 113.95 g/mol |
| Exact Mass | 114.09 |
| IUPAC Name | 2,4-dimethyl-1,3,2-dioxaborinane |
| SMILES | CB1OCCC(C)O1 |
| InChI | InChI=1S/C5H11BO2/c1-5-3-4-7-6(2)8-5/h5H,3-4H2,1-2H3 |
| InChIKey | RLDNRQYSPXEEMY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.95 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethyl-1,3,2-dioxaborinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-1,3,2-dioxaborinane?
The IUPAC name of 2,4-dimethyl-1,3,2-dioxaborinane (CID 23572285) is 2,4-dimethyl-1,3,2-dioxaborinane.
What is the SMILES notation for 2,4-dimethyl-1,3,2-dioxaborinane?
The canonical SMILES for 2,4-dimethyl-1,3,2-dioxaborinane is CB1OCCC(C)O1.
What is the InChIKey of 2,4-dimethyl-1,3,2-dioxaborinane?
The InChIKey is RLDNRQYSPXEEMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11BO2/c1-5-3-4-7-6(2)8-5/h5H,3-4H2,1-2H3.
What are the key properties of 2,4-dimethyl-1,3,2-dioxaborinane?
2,4-dimethyl-1,3,2-dioxaborinane has a molecular weight of 113.95 g/mol, XLogP of 0.93, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-1,3,2-dioxaborinane is sourced from PubChem (CID 23572285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).