C9H15F3O4S — CID 23573232
methyl 4-methyl-2-(trifluoromethylsulfonylmethyl)pentanoate (PubChem CID 23573232) has the molecular formula C9H15F3O4S and a molecular weight of 276.28 g/mol. Its IUPAC name is methyl 4-methyl-2-(trifluoromethylsulfonylmethyl)pentanoate.
| Compound Name | methyl 4-methyl-2-(trifluoromethylsulfonylmethyl)pentanoate |
|---|---|
| PubChem CID | 23573232 |
| Molecular Formula | C9H15F3O4S |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | methyl 4-methyl-2-(trifluoromethylsulfonylmethyl)pentanoate |
| SMILES | COC(=O)C(CC(C)C)CS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H15F3O4S/c1-6(2)4-7(8(13)16-3)5-17(14,15)9(10,11)12/h6-7H,4-5H2,1-3H3 |
| InChIKey | DPGXZYZJMLUGTA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |