About 2-propylhexyl 3-(5-ethyl-2-oxo-1,3-dioxolan-4-yl)propanoate
2-propylhexyl 3-(5-ethyl-2-oxo-1,3-dioxolan-4-yl)propanoate (PubChem CID 23573575) has the molecular formula C17H30O5
and a molecular weight of 314.42 g/mol. Its IUPAC name is 2-propylhexyl 3-(5-ethyl-2-oxo-1,3-dioxolan-4-yl)propanoate.
Analyze 2-propylhexyl 3-(5-ethyl-2-oxo-1,3-dioxolan-4-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylhexyl 3-(5-ethyl-2-oxo-1,3-dioxolan-4-yl)propanoate?
The IUPAC name of 2-propylhexyl 3-(5-ethyl-2-oxo-1,3-dioxolan-4-yl)propanoate (CID 23573575) is 2-propylhexyl 3-(5-ethyl-2-oxo-1,3-dioxolan-4-yl)propanoate.
What is the SMILES notation for 2-propylhexyl 3-(5-ethyl-2-oxo-1,3-dioxolan-4-yl)propanoate?
The canonical SMILES for 2-propylhexyl 3-(5-ethyl-2-oxo-1,3-dioxolan-4-yl)propanoate is CCCCC(CCC)COC(=O)CCC1OC(=O)OC1CC.
What is the InChIKey of 2-propylhexyl 3-(5-ethyl-2-oxo-1,3-dioxolan-4-yl)propanoate?
The InChIKey is MJBOXMWZACCGGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O5/c1-4-7-9-13(8-5-2)12-20-16(18)11-10-15-14(6-3)21-17(19)22-15/h13-15H,4-12H2,1-3H3.
What are the key properties of 2-propylhexyl 3-(5-ethyl-2-oxo-1,3-dioxolan-4-yl)propanoate?
2-propylhexyl 3-(5-ethyl-2-oxo-1,3-dioxolan-4-yl)propanoate has a molecular weight of 314.42 g/mol, XLogP of 4.23, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylhexyl 3-(5-ethyl-2-oxo-1,3-dioxolan-4-yl)propanoate is sourced from PubChem (CID 23573575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).