C40H35F2NO2 — CID 23574003
4-(21,26-difluoro-10-methoxy-5-phenyl-6-oxahexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-1(14),2(7),3,8(13),9,11,15,17,19-nonaen-5-yl)-N,N-dimethylaniline (PubChem CID 23574003) has the molecular formula C40H35F2NO2 and a molecular weight of 599.72 g/mol. Its IUPAC name is 4-(21,26-difluoro-10-methoxy-5-phenyl-6-oxahexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-1(14),2(7),3,8(13),9,11,15,17,19-nonaen-5-yl)-N,N-dimethylaniline.
| Compound Name | 4-(21,26-difluoro-10-methoxy-5-phenyl-6-oxahexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-1(14),2(7),3,8(13),9,11,15,17,19-nonaen-5-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 23574003 |
| Molecular Formula | C40H35F2NO2 |
| Molecular Weight | 599.72 g/mol |
| Exact Mass | 599.26 |
| IUPAC Name | 4-(21,26-difluoro-10-methoxy-5-phenyl-6-oxahexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-1(14),2(7),3,8(13),9,11,15,17,19-nonaen-5-yl)-N,N-dimethylaniline |
| SMILES | COc1ccc2c3c(c4c(c2c1)OC(c1ccccc1)(c1ccc(N(C)C)cc1)C=C4)C1(F)CCCCC1(F)c1ccccc1-3 |
| InChI | InChI=1S/C40H35F2NO2/c1-43(2)28-17-15-27(16-18-28)38(26-11-5-4-6-12-26)24-21-32-36-35(30-20-19-29(44-3)25-33(30)37(32)45-38)31-13-7-8-14-34(31)39(41)22-9-10-23-40(36,39)42/h4-8,11-21,24-25H,9-10,22-23H2,1-3H3 |
| InChIKey | QHFWAJUJFMIVMV-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.72 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|