C26H32N2O — CID 2825072
4-[[4-(dimethylamino)phenyl]-(4-methoxy-2,5-dimethylphenyl)methyl]-N,N-dimethylaniline (PubChem CID 2825072) has the molecular formula C26H32N2O and a molecular weight of 388.56 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]-(4-methoxy-2,5-dimethylphenyl)methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[4-(dimethylamino)phenyl]-(4-methoxy-2,5-dimethylphenyl)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 2825072 |
| Molecular Formula | C26H32N2O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]-(4-methoxy-2,5-dimethylphenyl)methyl]-N,N-dimethylaniline |
| SMILES | COc1cc(C)c(C(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1C |
| InChI | InChI=1S/C26H32N2O/c1-18-17-25(29-7)19(2)16-24(18)26(20-8-12-22(13-9-20)27(3)4)21-10-14-23(15-11-21)28(5)6/h8-17,26H,1-7H3 |
| InChIKey | PNGPWQXGWQKXCB-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|