C8H9F5O — CID 23574039
5,6,6,7,7-pentafluoro-2-methylhept-1-en-3-one (PubChem CID 23574039) has the molecular formula C8H9F5O and a molecular weight of 216.15 g/mol. Its IUPAC name is 5,6,6,7,7-pentafluoro-2-methylhept-1-en-3-one.
| Compound Name | 5,6,6,7,7-pentafluoro-2-methylhept-1-en-3-one |
|---|---|
| PubChem CID | 23574039 |
| Molecular Formula | C8H9F5O |
| Molecular Weight | 216.15 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 5,6,6,7,7-pentafluoro-2-methylhept-1-en-3-one |
| SMILES | C=C(C)C(=O)CC(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H9F5O/c1-4(2)5(14)3-6(9)8(12,13)7(10)11/h6-7H,1,3H2,2H3 |
| InChIKey | IFCHTLMUNXGVEH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.15 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|