C18H20N6O2 — CID 23577264
benzyl 3-[(7H-purin-6-ylamino)methyl]pyrrolidine-1-carboxylate (PubChem CID 23577264) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is benzyl 3-[(7H-purin-6-ylamino)methyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 3-[(7H-purin-6-ylamino)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 23577264 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | benzyl 3-[(7H-purin-6-ylamino)methyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC(CNc2ncnc3nc[nH]c23)C1 |
| InChI | InChI=1S/C18H20N6O2/c25-18(26-10-13-4-2-1-3-5-13)24-7-6-14(9-24)8-19-16-15-17(21-11-20-15)23-12-22-16/h1-5,11-12,14H,6-10H2,(H2,19,20,21,22,23) |
| InChIKey | XZSJRIXYFJGYLI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |