C18H24N4O2S — CID 23577294
N-[[1-(2-phenylethylsulfonyl)piperidin-4-yl]methyl]pyrazin-2-amine (PubChem CID 23577294) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is N-[[1-(2-phenylethylsulfonyl)piperidin-4-yl]methyl]pyrazin-2-amine.
| Compound Name | N-[[1-(2-phenylethylsulfonyl)piperidin-4-yl]methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 23577294 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-[[1-(2-phenylethylsulfonyl)piperidin-4-yl]methyl]pyrazin-2-amine |
| SMILES | O=S(=O)(CCc1ccccc1)N1CCC(CNc2cnccn2)CC1 |
| InChI | InChI=1S/C18H24N4O2S/c23-25(24,13-8-16-4-2-1-3-5-16)22-11-6-17(7-12-22)14-21-18-15-19-9-10-20-18/h1-5,9-10,15,17H,6-8,11-14H2,(H,20,21) |
| InChIKey | YBEHAAJXXATNNM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |