C32H24Cl2N6OS — CID 23577714
1-[4-(3-chlorophenyl)-6-[(4-chlorophenyl)-hydroxy-(3-methylimidazol-4-yl)methyl]quinazolin-2-yl]-3-phenylthiourea (PubChem CID 23577714) has the molecular formula C32H24Cl2N6OS and a molecular weight of 611.56 g/mol. Its IUPAC name is 1-[4-(3-chlorophenyl)-6-[(4-chlorophenyl)-hydroxy-(3-methylimidazol-4-yl)methyl]quinazolin-2-yl]-3-phenylthiourea.
| Compound Name | 1-[4-(3-chlorophenyl)-6-[(4-chlorophenyl)-hydroxy-(3-methylimidazol-4-yl)methyl]quinazolin-2-yl]-3-phenylthiourea |
|---|---|
| PubChem CID | 23577714 |
| Molecular Formula | C32H24Cl2N6OS |
| Molecular Weight | 611.56 g/mol |
| Exact Mass | 610.11 |
| IUPAC Name | 1-[4-(3-chlorophenyl)-6-[(4-chlorophenyl)-hydroxy-(3-methylimidazol-4-yl)methyl]quinazolin-2-yl]-3-phenylthiourea |
| SMILES | Cn1cncc1C(O)(c1ccc(Cl)cc1)c1ccc2nc(NC(=S)Nc3ccccc3)nc(-c3cccc(Cl)c3)c2c1 |
| InChI | InChI=1S/C32H24Cl2N6OS/c1-40-19-35-18-28(40)32(41,21-10-13-23(33)14-11-21)22-12-15-27-26(17-22)29(20-6-5-7-24(34)16-20)38-30(37-27)39-31(42)36-25-8-3-2-4-9-25/h2-19,41H,1H3,(H2,36,37,38,39,42) |
| InChIKey | QGGQYFBDXCRDLR-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.56 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|