C36H32Cl2N4OS — CID 23577718
[2-[(2-benzylsulfanylethylamino)methyl]-4-(3-chlorophenyl)quinolin-6-yl]-(4-chlorophenyl)-(3-methylimidazol-4-yl)methanol (PubChem CID 23577718) has the molecular formula C36H32Cl2N4OS and a molecular weight of 639.65 g/mol. Its IUPAC name is [2-[(2-benzylsulfanylethylamino)methyl]-4-(3-chlorophenyl)quinolin-6-yl]-(4-chlorophenyl)-(3-methylimidazol-4-yl)methanol.
| Compound Name | [2-[(2-benzylsulfanylethylamino)methyl]-4-(3-chlorophenyl)quinolin-6-yl]-(4-chlorophenyl)-(3-methylimidazol-4-yl)methanol |
|---|---|
| PubChem CID | 23577718 |
| Molecular Formula | C36H32Cl2N4OS |
| Molecular Weight | 639.65 g/mol |
| Exact Mass | 638.17 |
| IUPAC Name | [2-[(2-benzylsulfanylethylamino)methyl]-4-(3-chlorophenyl)quinolin-6-yl]-(4-chlorophenyl)-(3-methylimidazol-4-yl)methanol |
| SMILES | Cn1cncc1C(O)(c1ccc(Cl)cc1)c1ccc2nc(CNCCSCc3ccccc3)cc(-c3cccc(Cl)c3)c2c1 |
| InChI | InChI=1S/C36H32Cl2N4OS/c1-42-24-40-22-35(42)36(43,27-10-13-29(37)14-11-27)28-12-15-34-33(19-28)32(26-8-5-9-30(38)18-26)20-31(41-34)21-39-16-17-44-23-25-6-3-2-4-7-25/h2-15,18-20,22,24,39,43H,16-17,21,23H2,1H3 |
| InChIKey | XWBDMVFJCSPZQW-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.65 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|