C20H31N7O5 — CID 23577976
2-[5-[[(2-amino-2-methylpropanoyl)amino]-phenylmethoxymethyl]tetrazol-1-yl]ethyl N-(4-hydroxybutyl)carbamate (PubChem CID 23577976) has the molecular formula C20H31N7O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is 2-[5-[[(2-amino-2-methylpropanoyl)amino]-phenylmethoxymethyl]tetrazol-1-yl]ethyl N-(4-hydroxybutyl)carbamate.
| Compound Name | 2-[5-[[(2-amino-2-methylpropanoyl)amino]-phenylmethoxymethyl]tetrazol-1-yl]ethyl N-(4-hydroxybutyl)carbamate |
|---|---|
| PubChem CID | 23577976 |
| Molecular Formula | C20H31N7O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 2-[5-[[(2-amino-2-methylpropanoyl)amino]-phenylmethoxymethyl]tetrazol-1-yl]ethyl N-(4-hydroxybutyl)carbamate |
| SMILES | CC(C)(N)C(=O)NC(OCc1ccccc1)c1nnnn1CCOC(=O)NCCCCO |
| InChI | InChI=1S/C20H31N7O5/c1-20(2,21)18(29)23-17(32-14-15-8-4-3-5-9-15)16-24-25-26-27(16)11-13-31-19(30)22-10-6-7-12-28/h3-5,8-9,17,28H,6-7,10-14,21H2,1-2H3,(H,22,30)(H,23,29) |
| InChIKey | HBUSIZVFMFJYSG-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 166.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|