About 3-ethoxy-3-ethyloxetane
3-ethoxy-3-ethyloxetane (PubChem CID 23579058) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is 3-ethoxy-3-ethyloxetane.
Molecular Properties
| Compound Name | 3-ethoxy-3-ethyloxetane |
| PubChem CID | 23579058 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | 3-ethoxy-3-ethyloxetane |
| SMILES | CCOC1(CC)COC1 |
| InChI | InChI=1S/C7H14O2/c1-3-7(9-4-2)5-8-6-7/h3-6H2,1-2H3 |
| InChIKey | TVFRBKHANLKEEK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethoxy-3-ethyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-3-ethyloxetane?
The IUPAC name of 3-ethoxy-3-ethyloxetane (CID 23579058) is 3-ethoxy-3-ethyloxetane.
What is the SMILES notation for 3-ethoxy-3-ethyloxetane?
The canonical SMILES for 3-ethoxy-3-ethyloxetane is CCOC1(CC)COC1.
What is the InChIKey of 3-ethoxy-3-ethyloxetane?
The InChIKey is TVFRBKHANLKEEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2/c1-3-7(9-4-2)5-8-6-7/h3-6H2,1-2H3.
What are the key properties of 3-ethoxy-3-ethyloxetane?
3-ethoxy-3-ethyloxetane has a molecular weight of 130.19 g/mol, XLogP of 1.20, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-3-ethyloxetane is sourced from PubChem (CID 23579058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).