C23H23N3O9S — CID 2357921
[2-(2-methoxy-4-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 2357921) has the molecular formula C23H23N3O9S and a molecular weight of 517.52 g/mol. Its IUPAC name is [2-(2-methoxy-4-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [2-(2-methoxy-4-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 2357921 |
| Molecular Formula | C23H23N3O9S |
| Molecular Weight | 517.52 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | [2-(2-methoxy-4-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | COc1cc(S(=O)(=O)N2CCOCC2)ccc1NC(=O)COC(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H23N3O9S/c1-33-19-12-15(36(31,32)25-8-10-34-11-9-25)6-7-18(19)24-20(27)14-35-21(28)13-26-22(29)16-4-2-3-5-17(16)23(26)30/h2-7,12H,8-11,13-14H2,1H3,(H,24,27) |
| InChIKey | HBVRUCWKXAYKJE-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.52 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|