C28H27N3O8S — CID 4850522
5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)benzamide (PubChem CID 4850522) has the molecular formula C28H27N3O8S and a molecular weight of 565.60 g/mol. Its IUPAC name is 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)benzamide.
| Compound Name | 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 4850522 |
| Molecular Formula | C28H27N3O8S |
| Molecular Weight | 565.60 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)benzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)c1cc(CN2C(=O)c3ccccc3C2=O)ccc1OC |
| InChI | InChI=1S/C28H27N3O8S/c1-37-24-9-7-18(17-31-27(33)20-5-3-4-6-21(20)28(31)34)15-22(24)26(32)29-23-16-19(8-10-25(23)38-2)40(35,36)30-11-13-39-14-12-30/h3-10,15-16H,11-14,17H2,1-2H3,(H,29,32) |
| InChIKey | GHNWUMQBYWYAQU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.60 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|