C13H20N2O7 — CID 23584671
2-[bis(carboxymethyl)amino]-6-(prop-2-enoylamino)hexanoic acid (PubChem CID 23584671) has the molecular formula C13H20N2O7 and a molecular weight of 316.31 g/mol. Its IUPAC name is 2-[bis(carboxymethyl)amino]-6-(prop-2-enoylamino)hexanoic acid.
| Compound Name | 2-[bis(carboxymethyl)amino]-6-(prop-2-enoylamino)hexanoic acid |
|---|---|
| PubChem CID | 23584671 |
| Molecular Formula | C13H20N2O7 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 2-[bis(carboxymethyl)amino]-6-(prop-2-enoylamino)hexanoic acid |
| SMILES | C=CC(=O)NCCCCC(C(=O)O)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C13H20N2O7/c1-2-10(16)14-6-4-3-5-9(13(21)22)15(7-11(17)18)8-12(19)20/h2,9H,1,3-8H2,(H,14,16)(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | BZSSDSKNMXOYFT-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|