C15H20N2O3S — CID 23584716
2-[5-(pyrrolidin-1-ylmethylsulfonyl)-1H-indol-3-yl]ethanol (PubChem CID 23584716) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-[5-(pyrrolidin-1-ylmethylsulfonyl)-1H-indol-3-yl]ethanol.
| Compound Name | 2-[5-(pyrrolidin-1-ylmethylsulfonyl)-1H-indol-3-yl]ethanol |
|---|---|
| PubChem CID | 23584716 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2-[5-(pyrrolidin-1-ylmethylsulfonyl)-1H-indol-3-yl]ethanol |
| SMILES | O=S(=O)(CN1CCCC1)c1ccc2[nH]cc(CCO)c2c1 |
| InChI | InChI=1S/C15H20N2O3S/c18-8-5-12-10-16-15-4-3-13(9-14(12)15)21(19,20)11-17-6-1-2-7-17/h3-4,9-10,16,18H,1-2,5-8,11H2 |
| InChIKey | KPBZUHMNICLYFM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |