C15H13NO2S — CID 23584883
ethyl 2-thiophen-2-yl-1H-indole-3-carboxylate (PubChem CID 23584883) has the molecular formula C15H13NO2S and a molecular weight of 271.34 g/mol. Its IUPAC name is ethyl 2-thiophen-2-yl-1H-indole-3-carboxylate.
| Compound Name | ethyl 2-thiophen-2-yl-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 23584883 |
| Molecular Formula | C15H13NO2S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | ethyl 2-thiophen-2-yl-1H-indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccs2)[nH]c2ccccc12 |
| InChI | InChI=1S/C15H13NO2S/c1-2-18-15(17)13-10-6-3-4-7-11(10)16-14(13)12-8-5-9-19-12/h3-9,16H,2H2,1H3 |
| InChIKey | WZJAOPARSVWDDD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |