C28H33N2NaO8S2 — CID 23586388
sodium 3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3-(5-carboxypentyl)-3-methyl-5-oxidoperoxysulfanylindol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 23586388) has the molecular formula C28H33N2NaO8S2 and a molecular weight of 612.70 g/mol. Its IUPAC name is sodium 3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3-(5-carboxypentyl)-3-methyl-5-oxidoperoxysulfanylindol-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | sodium 3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3-(5-carboxypentyl)-3-methyl-5-oxidoperoxysulfanylindol-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 23586388 |
| Molecular Formula | C28H33N2NaO8S2 |
| Molecular Weight | 612.70 g/mol |
| Exact Mass | 612.16 |
| IUPAC Name | sodium 3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3-(5-carboxypentyl)-3-methyl-5-oxidoperoxysulfanylindol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | CC1(CCCCCC(=O)O)C(/C=C/C=C/Nc2ccccc2)=[N+](CCCS(=O)(=O)[O-])c2ccc(SOO[O-])cc21.[Na+] |
| InChI | InChI=1S/C28H34N2O8S2.Na/c1-28(17-8-3-6-14-27(31)32)24-21-23(39-38-37-33)15-16-25(24)30(19-10-20-40(34,35)36)26(28)13-7-9-18-29-22-11-4-2-5-12-22;/h2,4-5,7,9,11-13,15-16,18,21H,3,6,8,10,14,17,19-20H2,1H3,(H3,31,32,33,34,35,36);/q;+1/p-1 |
| InChIKey | HJWLRVFXEVSPET-UHFFFAOYSA-M |
| XLogP | 1.43 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.70 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|