C17H24NO5S+ — CID 13008016
6-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)hexanoic acid (PubChem CID 13008016) has the molecular formula C17H24NO5S+ and a molecular weight of 354.45 g/mol. Its IUPAC name is 6-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)hexanoic acid.
| Compound Name | 6-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)hexanoic acid |
|---|---|
| PubChem CID | 13008016 |
| Molecular Formula | C17H24NO5S+ |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 6-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)hexanoic acid |
| SMILES | CC1=[N+](CCCCCC(=O)O)c2ccc(S(=O)(=O)O)cc2C1(C)C |
| InChI | InChI=1S/C17H23NO5S/c1-12-17(2,3)14-11-13(24(21,22)23)8-9-15(14)18(12)10-6-4-5-7-16(19)20/h8-9,11H,4-7,10H2,1-3H3,(H-,19,20,21,22,23)/p+1 |
| InChIKey | VNVVCYZHLDDZFJ-UHFFFAOYSA-O |
| XLogP | 2.97 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|