6-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)hexanoic acid

C17H24NO5S+ — CID 13008016

IUPAC6-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)hexanoic acid
SMILESCC1=[N+](CCCCCC(=O)O)c2ccc(S(=O)(=O)O)cc2C1(C)C
InChIInChI=1S/C17H23NO5S/c1-12-17(2,3)14-11-13(24(21,22)23)8-9-15(14)18(12)10-6-4-5-7-16(19)20/h8-9,11H,4-7,10H2,1-3H3,(H-,19,20,21,22,23)/p+1
InChIKeyVNVVCYZHLDDZFJ-UHFFFAOYSA-O
MW354.45 g/mol
LogP2.97
Rot. Bonds7

About 6-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)hexanoic acid

6-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)hexanoic acid (PubChem CID 13008016) has the molecular formula C17H24NO5S+ and a molecular weight of 354.45 g/mol. Its IUPAC name is 6-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)hexanoic acid.

Molecular Properties

Compound Name6-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)hexanoic acid
PubChem CID13008016
Molecular FormulaC17H24NO5S+
Molecular Weight354.45 g/mol
Exact Mass354.14
IUPAC Name6-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)hexanoic acid
SMILESCC1=[N+](CCCCCC(=O)O)c2ccc(S(=O)(=O)O)cc2C1(C)C
InChIInChI=1S/C17H23NO5S/c1-12-17(2,3)14-11-13(24(21,22)23)8-9-15(14)18(12)10-6-4-5-7-16(19)20/h8-9,11H,4-7,10H2,1-3H3,(H-,19,20,21,22,23)/p+1
InChIKeyVNVVCYZHLDDZFJ-UHFFFAOYSA-O
XLogP2.97
TPSA94.68 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500354.45
LogP ≤ 52.97
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 6-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)hexanoic acid?
The IUPAC name of 6-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)hexanoic acid (CID 13008016) is 6-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)hexanoic acid.
What is the SMILES notation for 6-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)hexanoic acid?
The canonical SMILES for 6-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)hexanoic acid is CC1=[N+](CCCCCC(=O)O)c2ccc(S(=O)(=O)O)cc2C1(C)C.
What is the InChIKey of 6-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)hexanoic acid?
The InChIKey is VNVVCYZHLDDZFJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H23NO5S/c1-12-17(2,3)14-11-13(24(21,22)23)8-9-15(14)18(12)10-6-4-5-7-16(19)20/h8-9,11H,4-7,10H2,1-3H3,(H-,19,20,21,22,23)/p+1.
What are the key properties of 6-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)hexanoic acid?
6-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)hexanoic acid has a molecular weight of 354.45 g/mol, XLogP of 2.97, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)hexanoic acid is sourced from PubChem (CID 13008016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).